C18H13BrClN7O4 — CID 19465237
5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-[1-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]furan-2-carboxamide (PubChem CID 19465237) has the molecular formula C18H13BrClN7O4 and a molecular weight of 506.70 g/mol. Its IUPAC name is 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-[1-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]furan-2-carboxamide.
| Compound Name | 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-[1-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19465237 |
| Molecular Formula | C18H13BrClN7O4 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 504.99 |
| IUPAC Name | 5-[(4-bromo-3-nitropyrazol-1-yl)methyl]-N-[1-[(4-chlorophenyl)methyl]-1,2,4-triazol-3-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1ncn(Cc2ccc(Cl)cc2)n1)c1ccc(Cn2cc(Br)c([N+](=O)[O-])n2)o1 |
| InChI | InChI=1S/C18H13BrClN7O4/c19-14-9-25(23-16(14)27(29)30)8-13-5-6-15(31-13)17(28)22-18-21-10-26(24-18)7-11-1-3-12(20)4-2-11/h1-6,9-10H,7-8H2,(H,22,24,28) |
| InChIKey | FCBNUBUNKGLJEO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|