C18H14ClN7O4 — CID 19460890
N-[1-[(2-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide (PubChem CID 19460890) has the molecular formula C18H14ClN7O4 and a molecular weight of 427.81 g/mol. Its IUPAC name is N-[1-[(2-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[1-[(2-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19460890 |
| Molecular Formula | C18H14ClN7O4 |
| Molecular Weight | 427.81 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | N-[1-[(2-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ncn(Cc2ccccc2Cl)n1)c1ccc(Cn2cc([N+](=O)[O-])cn2)o1 |
| InChI | InChI=1S/C18H14ClN7O4/c19-15-4-2-1-3-12(15)8-25-11-20-18(23-25)22-17(27)16-6-5-14(30-16)10-24-9-13(7-21-24)26(28)29/h1-7,9,11H,8,10H2,(H,22,23,27) |
| InChIKey | NYDLQTJCURBVCR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.81 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|