C13H10ClN7O3 — CID 19479673
N-[1-[(2-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 19479673) has the molecular formula C13H10ClN7O3 and a molecular weight of 347.72 g/mol. Its IUPAC name is N-[1-[(2-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-[1-[(2-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19479673 |
| Molecular Formula | C13H10ClN7O3 |
| Molecular Weight | 347.72 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | N-[1-[(2-chlorophenyl)methyl]-1,2,4-triazol-3-yl]-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1ncn(Cc2ccccc2Cl)n1)c1[nH]ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H10ClN7O3/c14-9-4-2-1-3-8(9)6-20-7-15-13(19-20)17-12(22)11-10(21(23)24)5-16-18-11/h1-5,7H,6H2,(H,16,18)(H,17,19,22) |
| InChIKey | XIFJFWMYFKUNQV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 131.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.72 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|