C10H7ClN4O4 — CID 75436462
N-(3-chloro-2-hydroxyphenyl)-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 75436462) has the molecular formula C10H7ClN4O4 and a molecular weight of 282.64 g/mol. Its IUPAC name is N-(3-chloro-2-hydroxyphenyl)-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-(3-chloro-2-hydroxyphenyl)-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 75436462 |
| Molecular Formula | C10H7ClN4O4 |
| Molecular Weight | 282.64 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | N-(3-chloro-2-hydroxyphenyl)-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1O)c1[nH]ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7ClN4O4/c11-5-2-1-3-6(9(5)16)13-10(17)8-7(15(18)19)4-12-14-8/h1-4,16H,(H,12,14)(H,13,17) |
| InChIKey | UJWICXLFISMXKJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.64 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|