C9H9N5O4 — CID 19479748
N-(3,5-dimethyl-1,2-oxazol-4-yl)-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 19479748) has the molecular formula C9H9N5O4 and a molecular weight of 251.20 g/mol. Its IUPAC name is N-(3,5-dimethyl-1,2-oxazol-4-yl)-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-(3,5-dimethyl-1,2-oxazol-4-yl)-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19479748 |
| Molecular Formula | C9H9N5O4 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | N-(3,5-dimethyl-1,2-oxazol-4-yl)-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | Cc1noc(C)c1NC(=O)c1[nH]ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9N5O4/c1-4-7(5(2)18-13-4)11-9(15)8-6(14(16)17)3-10-12-8/h3H,1-2H3,(H,10,12)(H,11,15) |
| InChIKey | MGLPTRRHYPIRFU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|