C13H12N4O7S — CID 19479533
dimethyl 3-methyl-5-[(4-nitro-1H-pyrazole-5-carbonyl)amino]thiophene-2,4-dicarboxylate (PubChem CID 19479533) has the molecular formula C13H12N4O7S and a molecular weight of 368.33 g/mol. Its IUPAC name is dimethyl 3-methyl-5-[(4-nitro-1H-pyrazole-5-carbonyl)amino]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 3-methyl-5-[(4-nitro-1H-pyrazole-5-carbonyl)amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19479533 |
| Molecular Formula | C13H12N4O7S |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | dimethyl 3-methyl-5-[(4-nitro-1H-pyrazole-5-carbonyl)amino]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(NC(=O)c2[nH]ncc2[N+](=O)[O-])c(C(=O)OC)c1C |
| InChI | InChI=1S/C13H12N4O7S/c1-5-7(12(19)23-2)11(25-9(5)13(20)24-3)15-10(18)8-6(17(21)22)4-14-16-8/h4H,1-3H3,(H,14,16)(H,15,18) |
| InChIKey | CWKAEWUCRAVRKF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 153.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|