C15H16N4O7S — CID 19476349
dimethyl 5-[(1-ethyl-4-nitropyrazole-5-carbonyl)amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 19476349) has the molecular formula C15H16N4O7S and a molecular weight of 396.38 g/mol. Its IUPAC name is dimethyl 5-[(1-ethyl-4-nitropyrazole-5-carbonyl)amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-[(1-ethyl-4-nitropyrazole-5-carbonyl)amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19476349 |
| Molecular Formula | C15H16N4O7S |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | dimethyl 5-[(1-ethyl-4-nitropyrazole-5-carbonyl)amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCn1ncc([N+](=O)[O-])c1C(=O)Nc1sc(C(=O)OC)c(C)c1C(=O)OC |
| InChI | InChI=1S/C15H16N4O7S/c1-5-18-10(8(6-16-18)19(23)24)12(20)17-13-9(14(21)25-3)7(2)11(27-13)15(22)26-4/h6H,5H2,1-4H3,(H,17,20) |
| InChIKey | AUDWHMOQGORWSO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 142.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|