C9H12N4O5 — CID 19476462
methyl 2-[(1-ethyl-4-nitropyrazole-5-carbonyl)amino]acetate (PubChem CID 19476462) has the molecular formula C9H12N4O5 and a molecular weight of 256.22 g/mol. Its IUPAC name is methyl 2-[(1-ethyl-4-nitropyrazole-5-carbonyl)amino]acetate.
| Compound Name | methyl 2-[(1-ethyl-4-nitropyrazole-5-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 19476462 |
| Molecular Formula | C9H12N4O5 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | methyl 2-[(1-ethyl-4-nitropyrazole-5-carbonyl)amino]acetate |
| SMILES | CCn1ncc([N+](=O)[O-])c1C(=O)NCC(=O)OC |
| InChI | InChI=1S/C9H12N4O5/c1-3-12-8(6(4-11-12)13(16)17)9(15)10-5-7(14)18-2/h4H,3,5H2,1-2H3,(H,10,15) |
| InChIKey | JCRIEIVMQPOHOD-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|