C16H26N4O3 — CID 19575478
N-(4-tert-butylcyclohexyl)-1-ethyl-4-nitropyrazole-5-carboxamide (PubChem CID 19575478) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-(4-tert-butylcyclohexyl)-1-ethyl-4-nitropyrazole-5-carboxamide.
| Compound Name | N-(4-tert-butylcyclohexyl)-1-ethyl-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19575478 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N-(4-tert-butylcyclohexyl)-1-ethyl-4-nitropyrazole-5-carboxamide |
| SMILES | CCn1ncc([N+](=O)[O-])c1C(=O)NC1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H26N4O3/c1-5-19-14(13(10-17-19)20(22)23)15(21)18-12-8-6-11(7-9-12)16(2,3)4/h10-12H,5-9H2,1-4H3,(H,18,21) |
| InChIKey | QVZVDZGAGCVYSW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|