C13H21N5O4 — CID 51616577
1-ethyl-N-[(2S)-1-morpholin-4-ylpropan-2-yl]-4-nitropyrazole-5-carboxamide (PubChem CID 51616577) has the molecular formula C13H21N5O4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 1-ethyl-N-[(2S)-1-morpholin-4-ylpropan-2-yl]-4-nitropyrazole-5-carboxamide.
| Compound Name | 1-ethyl-N-[(2S)-1-morpholin-4-ylpropan-2-yl]-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 51616577 |
| Molecular Formula | C13H21N5O4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 1-ethyl-N-[(2S)-1-morpholin-4-ylpropan-2-yl]-4-nitropyrazole-5-carboxamide |
| SMILES | CCn1ncc([N+](=O)[O-])c1C(=O)N[C@@H](C)CN1CCOCC1 |
| InChI | InChI=1S/C13H21N5O4/c1-3-17-12(11(8-14-17)18(20)21)13(19)15-10(2)9-16-4-6-22-7-5-16/h8,10H,3-7,9H2,1-2H3,(H,15,19)/t10-/m0/s1 |
| InChIKey | RZLAWJOITQKFON-JTQLQIEISA-N |
| XLogP | 0.26 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|