C16H19N5O6S — CID 19479541
propyl 5-(dimethylcarbamoyl)-4-methyl-2-[(4-nitro-1H-pyrazole-5-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 19479541) has the molecular formula C16H19N5O6S and a molecular weight of 409.42 g/mol. Its IUPAC name is propyl 5-(dimethylcarbamoyl)-4-methyl-2-[(4-nitro-1H-pyrazole-5-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | propyl 5-(dimethylcarbamoyl)-4-methyl-2-[(4-nitro-1H-pyrazole-5-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19479541 |
| Molecular Formula | C16H19N5O6S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | propyl 5-(dimethylcarbamoyl)-4-methyl-2-[(4-nitro-1H-pyrazole-5-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | CCCOC(=O)c1c(NC(=O)c2[nH]ncc2[N+](=O)[O-])sc(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C16H19N5O6S/c1-5-6-27-16(24)10-8(2)12(15(23)20(3)4)28-14(10)18-13(22)11-9(21(25)26)7-17-19-11/h7H,5-6H2,1-4H3,(H,17,19)(H,18,22) |
| InChIKey | LFNLMMOOGDBVGT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 147.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|