C20H27N5O6S — CID 19568219
propyl 5-(dimethylcarbamoyl)-4-methyl-2-[[2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)propanoyl]amino]thiophene-3-carboxylate (PubChem CID 19568219) has the molecular formula C20H27N5O6S and a molecular weight of 465.53 g/mol. Its IUPAC name is propyl 5-(dimethylcarbamoyl)-4-methyl-2-[[2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)propanoyl]amino]thiophene-3-carboxylate.
| Compound Name | propyl 5-(dimethylcarbamoyl)-4-methyl-2-[[2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)propanoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19568219 |
| Molecular Formula | C20H27N5O6S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | propyl 5-(dimethylcarbamoyl)-4-methyl-2-[[2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)propanoyl]amino]thiophene-3-carboxylate |
| SMILES | CCCOC(=O)c1c(NC(=O)C(C)Cn2nc([N+](=O)[O-])cc2C)sc(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C20H27N5O6S/c1-7-8-31-20(28)15-13(4)16(19(27)23(5)6)32-18(15)21-17(26)11(2)10-24-12(3)9-14(22-24)25(29)30/h9,11H,7-8,10H2,1-6H3,(H,21,26) |
| InChIKey | ROOIMCOKZBIZQA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 136.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|