C22H22F5N5O4S — CID 19455787
propyl 5-(dimethylcarbamoyl)-4-methyl-2-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 19455787) has the molecular formula C22H22F5N5O4S and a molecular weight of 547.51 g/mol. Its IUPAC name is propyl 5-(dimethylcarbamoyl)-4-methyl-2-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | propyl 5-(dimethylcarbamoyl)-4-methyl-2-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19455787 |
| Molecular Formula | C22H22F5N5O4S |
| Molecular Weight | 547.51 g/mol |
| Exact Mass | 547.13 |
| IUPAC Name | propyl 5-(dimethylcarbamoyl)-4-methyl-2-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | CCCOC(=O)c1c(NC(=O)c2cc3nc(C)cc(C(F)(F)C(F)(F)F)n3n2)sc(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C22H22F5N5O4S/c1-6-7-36-20(35)15-11(3)16(19(34)31(4)5)37-18(15)29-17(33)12-9-14-28-10(2)8-13(32(14)30-12)21(23,24)22(25,26)27/h8-9H,6-7H2,1-5H3,(H,29,33) |
| InChIKey | JXFXJCACHQQYLI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|