C19H16F5N5O4S — CID 19455790
ethyl 5-carbamoyl-4-methyl-2-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 19455790) has the molecular formula C19H16F5N5O4S and a molecular weight of 505.43 g/mol. Its IUPAC name is ethyl 5-carbamoyl-4-methyl-2-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-carbamoyl-4-methyl-2-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19455790 |
| Molecular Formula | C19H16F5N5O4S |
| Molecular Weight | 505.43 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | ethyl 5-carbamoyl-4-methyl-2-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cc3nc(C)cc(C(F)(F)C(F)(F)F)n3n2)sc(C(N)=O)c1C |
| InChI | InChI=1S/C19H16F5N5O4S/c1-4-33-17(32)12-8(3)13(14(25)30)34-16(12)27-15(31)9-6-11-26-7(2)5-10(29(11)28-9)18(20,21)19(22,23)24/h5-6H,4H2,1-3H3,(H2,25,30)(H,27,31) |
| InChIKey | IWEKDPYBKTWBDX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 128.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|