C22H21F5N4O3S — CID 19455789
propyl 2-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19455789) has the molecular formula C22H21F5N4O3S and a molecular weight of 516.49 g/mol. Its IUPAC name is propyl 2-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | propyl 2-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19455789 |
| Molecular Formula | C22H21F5N4O3S |
| Molecular Weight | 516.49 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | propyl 2-[[5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCCOC(=O)c1c(NC(=O)c2cc3nc(C)cc(C(F)(F)C(F)(F)F)n3n2)sc2c1CCCC2 |
| InChI | InChI=1S/C22H21F5N4O3S/c1-3-8-34-20(33)17-12-6-4-5-7-14(12)35-19(17)29-18(32)13-10-16-28-11(2)9-15(31(16)30-13)21(23,24)22(25,26)27/h9-10H,3-8H2,1-2H3,(H,29,32) |
| InChIKey | MAKOMKFYYKOEKY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|