C15H19Cl2NO3S — CID 4205068
propyl 2-[(2,2-dichloroacetyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 4205068) has the molecular formula C15H19Cl2NO3S and a molecular weight of 364.29 g/mol. Its IUPAC name is propyl 2-[(2,2-dichloroacetyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | propyl 2-[(2,2-dichloroacetyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4205068 |
| Molecular Formula | C15H19Cl2NO3S |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | propyl 2-[(2,2-dichloroacetyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CCCOC(=O)c1c(NC(=O)C(Cl)Cl)sc2c1CCCCC2 |
| InChI | InChI=1S/C15H19Cl2NO3S/c1-2-8-21-15(20)11-9-6-4-3-5-7-10(9)22-14(11)18-13(19)12(16)17/h12H,2-8H2,1H3,(H,18,19) |
| InChIKey | BORGVTLFWQZNNE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|