C18H18F9NO3S — CID 3323507
propyl 2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 3323507) has the molecular formula C18H18F9NO3S and a molecular weight of 499.40 g/mol. Its IUPAC name is propyl 2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | propyl 2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3323507 |
| Molecular Formula | C18H18F9NO3S |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | propyl 2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CCCOC(=O)c1c(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)sc2c1CCCCC2 |
| InChI | InChI=1S/C18H18F9NO3S/c1-2-8-31-13(29)11-9-6-4-3-5-7-10(9)32-12(11)28-14(30)15(19,20)16(21,22)17(23,24)18(25,26)27/h2-8H2,1H3,(H,28,30) |
| InChIKey | JMIPXJQXSYMDGS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|