C19H13ClF16N2O2S — CID 3533611
2-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide (PubChem CID 3533611) has the molecular formula C19H13ClF16N2O2S and a molecular weight of 672.81 g/mol. Its IUPAC name is 2-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide.
| Compound Name | 2-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 3533611 |
| Molecular Formula | C19H13ClF16N2O2S |
| Molecular Weight | 672.81 g/mol |
| Exact Mass | 672.01 |
| IUPAC Name | 2-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)sc2c1CCCCC2 |
| InChI | InChI=1S/C19H13ClF16N2O2S/c20-19(35,36)18(33,34)17(31,32)16(29,30)15(27,28)14(25,26)13(23,24)12(21,22)11(40)38-10-8(9(37)39)6-4-2-1-3-5-7(6)41-10/h1-5H2,(H2,37,39)(H,38,40) |
| InChIKey | JIEYBKMJNYXVGL-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.81 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|