C19H12ClF16NO3S — CID 5143899
ethyl 2-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 5143899) has the molecular formula C19H12ClF16NO3S and a molecular weight of 673.80 g/mol. Its IUPAC name is ethyl 2-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 5143899 |
| Molecular Formula | C19H12ClF16NO3S |
| Molecular Weight | 673.80 g/mol |
| Exact Mass | 673.00 |
| IUPAC Name | ethyl 2-[(9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)sc2c1CCC2 |
| InChI | InChI=1S/C19H12ClF16NO3S/c1-2-40-10(38)8-6-4-3-5-7(6)41-9(8)37-11(39)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)17(31,32)18(33,34)19(20,35)36/h2-5H2,1H3,(H,37,39) |
| InChIKey | KDMOALCFMWDMDB-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.80 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|