C17H16F9NO3S — CID 5210024
propan-2-yl 2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 5210024) has the molecular formula C17H16F9NO3S and a molecular weight of 485.37 g/mol. Its IUPAC name is propan-2-yl 2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 5210024 |
| Molecular Formula | C17H16F9NO3S |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | propan-2-yl 2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CC(C)OC(=O)c1c(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)sc2c1CCCC2 |
| InChI | InChI=1S/C17H16F9NO3S/c1-7(2)30-12(28)10-8-5-3-4-6-9(8)31-11(10)27-13(29)14(18,19)15(20,21)16(22,23)17(24,25)26/h7H,3-6H2,1-2H3,(H,27,29) |
| InChIKey | DYQHNONDDXBWGF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|