C32H44N2O6S2 — CID 4160751
propan-2-yl 2-[[6-oxo-6-[(3-propan-2-yloxycarbonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]hexanoyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 4160751) has the molecular formula C32H44N2O6S2 and a molecular weight of 616.85 g/mol. Its IUPAC name is propan-2-yl 2-[[6-oxo-6-[(3-propan-2-yloxycarbonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]hexanoyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[[6-oxo-6-[(3-propan-2-yloxycarbonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]hexanoyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4160751 |
| Molecular Formula | C32H44N2O6S2 |
| Molecular Weight | 616.85 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | propan-2-yl 2-[[6-oxo-6-[(3-propan-2-yloxycarbonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]hexanoyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CC(C)OC(=O)c1c(NC(=O)CCCCC(=O)Nc2sc3c(c2C(=O)OC(C)C)CCCCC3)sc2c1CCCCC2 |
| InChI | InChI=1S/C32H44N2O6S2/c1-19(2)39-31(37)27-21-13-7-5-9-15-23(21)41-29(27)33-25(35)17-11-12-18-26(36)34-30-28(32(38)40-20(3)4)22-14-8-6-10-16-24(22)42-30/h19-20H,5-18H2,1-4H3,(H,33,35)(H,34,36) |
| InChIKey | FFHUWUHFMGRWNK-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.85 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|