C17H24ClNO3S — CID 3341185
propan-2-yl 2-(4-chlorobutanoylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 3341185) has the molecular formula C17H24ClNO3S and a molecular weight of 357.90 g/mol. Its IUPAC name is propan-2-yl 2-(4-chlorobutanoylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-(4-chlorobutanoylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3341185 |
| Molecular Formula | C17H24ClNO3S |
| Molecular Weight | 357.90 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | propan-2-yl 2-(4-chlorobutanoylamino)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CC(C)OC(=O)c1c(NC(=O)CCCCl)sc2c1CCCCC2 |
| InChI | InChI=1S/C17H24ClNO3S/c1-11(2)22-17(21)15-12-7-4-3-5-8-13(12)23-16(15)19-14(20)9-6-10-18/h11H,3-10H2,1-2H3,(H,19,20) |
| InChIKey | HJFPINDYHVINRU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.90 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|