C16H15F9N2O2S — CID 5091755
2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide (PubChem CID 5091755) has the molecular formula C16H15F9N2O2S and a molecular weight of 470.36 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide.
| Compound Name | 2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 5091755 |
| Molecular Formula | C16H15F9N2O2S |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)sc2c1CCCCCC2 |
| InChI | InChI=1S/C16H15F9N2O2S/c17-13(18,14(19,20)15(21,22)16(23,24)25)12(29)27-11-9(10(26)28)7-5-3-1-2-4-6-8(7)30-11/h1-6H2,(H2,26,28)(H,27,29) |
| InChIKey | AUNYWIJITDBTSR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|