C18H21F7N2O2S — CID 5085472
2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 5085472) has the molecular formula C18H21F7N2O2S and a molecular weight of 462.43 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 5085472 |
| Molecular Formula | C18H21F7N2O2S |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCC(C)(C)C1CCc2c(sc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c2C(N)=O)C1 |
| InChI | InChI=1S/C18H21F7N2O2S/c1-4-15(2,3)8-5-6-9-10(7-8)30-13(11(9)12(26)28)27-14(29)16(19,20)17(21,22)18(23,24)25/h8H,4-7H2,1-3H3,(H2,26,28)(H,27,29) |
| InChIKey | CYKVBBNYEWXFAR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|