C17H12F12N2OS — CID 3618773
N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanamide (PubChem CID 3618773) has the molecular formula C17H12F12N2OS and a molecular weight of 520.34 g/mol. Its IUPAC name is N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanamide.
| Compound Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanamide |
|---|---|
| PubChem CID | 3618773 |
| Molecular Formula | C17H12F12N2OS |
| Molecular Weight | 520.34 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanamide |
| SMILES | N#Cc1c(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)sc2c1CCCCC2 |
| InChI | InChI=1S/C17H12F12N2OS/c18-11(19)13(20,21)15(24,25)17(28,29)16(26,27)14(22,23)12(32)31-10-8(6-30)7-4-2-1-3-5-9(7)33-10/h11H,1-5H2,(H,31,32) |
| InChIKey | DHSJKIXXHSFMLO-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.34 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|