C15H11F9N2OS — CID 40738580
N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2,2,3,3,4,4,5,5,5-nonafluoropentanamide (PubChem CID 40738580) has the molecular formula C15H11F9N2OS and a molecular weight of 438.32 g/mol. Its IUPAC name is N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2,2,3,3,4,4,5,5,5-nonafluoropentanamide.
| Compound Name | N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2,2,3,3,4,4,5,5,5-nonafluoropentanamide |
|---|---|
| PubChem CID | 40738580 |
| Molecular Formula | C15H11F9N2OS |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | N-[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2,2,3,3,4,4,5,5,5-nonafluoropentanamide |
| SMILES | C[C@@H]1CCc2c(sc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c2C#N)C1 |
| InChI | InChI=1S/C15H11F9N2OS/c1-6-2-3-7-8(5-25)10(28-9(7)4-6)26-11(27)12(16,17)13(18,19)14(20,21)15(22,23)24/h6H,2-4H2,1H3,(H,26,27)/t6-/m1/s1 |
| InChIKey | YPWJUYSPRHECOD-ZCFIWIBFSA-N |
| XLogP | 5.15 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|