C13H12Cl3N3OS2 — CID 40640709
2,2,2-trichloro-N-[[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]acetamide (PubChem CID 40640709) has the molecular formula C13H12Cl3N3OS2 and a molecular weight of 396.75 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 40640709 |
| Molecular Formula | C13H12Cl3N3OS2 |
| Molecular Weight | 396.75 g/mol |
| Exact Mass | 394.95 |
| IUPAC Name | 2,2,2-trichloro-N-[[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]acetamide |
| SMILES | C[C@@H]1CCc2c(sc(NC(=S)NC(=O)C(Cl)(Cl)Cl)c2C#N)C1 |
| InChI | InChI=1S/C13H12Cl3N3OS2/c1-6-2-3-7-8(5-17)10(22-9(7)4-6)18-12(21)19-11(20)13(14,15)16/h6H,2-4H2,1H3,(H2,18,19,20,21)/t6-/m1/s1 |
| InChIKey | SXKZZWIJOKLWPJ-ZCFIWIBFSA-N |
| XLogP | 3.93 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.75 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|