C16H15N3O2S2 — CID 812570
N-[[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]furan-2-carboxamide (PubChem CID 812570) has the molecular formula C16H15N3O2S2 and a molecular weight of 345.45 g/mol. Its IUPAC name is N-[[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]furan-2-carboxamide.
| Compound Name | N-[[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 812570 |
| Molecular Formula | C16H15N3O2S2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-[[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]furan-2-carboxamide |
| SMILES | C[C@@H]1CCc2c(sc(NC(=S)NC(=O)c3ccco3)c2C#N)C1 |
| InChI | InChI=1S/C16H15N3O2S2/c1-9-4-5-10-11(8-17)15(23-13(10)7-9)19-16(22)18-14(20)12-3-2-6-21-12/h2-3,6,9H,4-5,7H2,1H3,(H2,18,19,20,22)/t9-/m1/s1 |
| InChIKey | AHTZTOKJEIRBTO-SECBINFHSA-N |
| XLogP | 3.46 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|