C22H18Cl2N4O2S2 — CID 3132672
N-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 3132672) has the molecular formula C22H18Cl2N4O2S2 and a molecular weight of 505.45 g/mol. Its IUPAC name is N-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3132672 |
| Molecular Formula | C22H18Cl2N4O2S2 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | N-[(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)NC(=S)Nc1sc2c(c1C#N)CCC(C)C2 |
| InChI | InChI=1S/C22H18Cl2N4O2S2/c1-10-6-7-12-13(9-25)21(32-16(12)8-10)27-22(31)26-20(29)17-11(2)30-28-19(17)18-14(23)4-3-5-15(18)24/h3-5,10H,6-8H2,1-2H3,(H2,26,27,29,31) |
| InChIKey | ZVNZQGWVAMIVPW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|