C18H16FN3OS2 — CID 40640722
N-[[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]-2-fluorobenzamide (PubChem CID 40640722) has the molecular formula C18H16FN3OS2 and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]-2-fluorobenzamide.
| Compound Name | N-[[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 40640722 |
| Molecular Formula | C18H16FN3OS2 |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N-[[(6R)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]-2-fluorobenzamide |
| SMILES | C[C@@H]1CCc2c(sc(NC(=S)NC(=O)c3ccccc3F)c2C#N)C1 |
| InChI | InChI=1S/C18H16FN3OS2/c1-10-6-7-11-13(9-20)17(25-15(11)8-10)22-18(24)21-16(23)12-4-2-3-5-14(12)19/h2-5,10H,6-8H2,1H3,(H2,21,22,23,24)/t10-/m1/s1 |
| InChIKey | VWXOUZKNZOZSCL-SNVBAGLBSA-N |
| XLogP | 4.01 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|