C21H22BrN3OS2 — CID 26020263
2-bromo-N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]benzamide (PubChem CID 26020263) has the molecular formula C21H22BrN3OS2 and a molecular weight of 476.47 g/mol. Its IUPAC name is 2-bromo-N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]benzamide.
| Compound Name | 2-bromo-N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 26020263 |
| Molecular Formula | C21H22BrN3OS2 |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | 2-bromo-N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]benzamide |
| SMILES | CC(C)(C)[C@@H]1CCc2c(sc(NC(=S)NC(=O)c3ccccc3Br)c2C#N)C1 |
| InChI | InChI=1S/C21H22BrN3OS2/c1-21(2,3)12-8-9-13-15(11-23)19(28-17(13)10-12)25-20(27)24-18(26)14-6-4-5-7-16(14)22/h4-7,12H,8-10H2,1-3H3,(H2,24,25,26,27)/t12-/m1/s1 |
| InChIKey | FTMNEDFEESSFMN-GFCCVEGCSA-N |
| XLogP | 5.66 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|