C28H29N3O2S2 — CID 26020277
N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]-4-phenylmethoxybenzamide (PubChem CID 26020277) has the molecular formula C28H29N3O2S2 and a molecular weight of 503.69 g/mol. Its IUPAC name is N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]-4-phenylmethoxybenzamide.
| Compound Name | N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 26020277 |
| Molecular Formula | C28H29N3O2S2 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]-4-phenylmethoxybenzamide |
| SMILES | CC(C)(C)[C@@H]1CCc2c(sc(NC(=S)NC(=O)c3ccc(OCc4ccccc4)cc3)c2C#N)C1 |
| InChI | InChI=1S/C28H29N3O2S2/c1-28(2,3)20-11-14-22-23(16-29)26(35-24(22)15-20)31-27(34)30-25(32)19-9-12-21(13-10-19)33-17-18-7-5-4-6-8-18/h4-10,12-13,20H,11,14-15,17H2,1-3H3,(H2,30,31,32,34)/t20-/m1/s1 |
| InChIKey | QEKXHIUWFDSMBL-HXUWFJFHSA-N |
| XLogP | 6.48 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|