C25H31N3O2S2 — CID 17109914
4-butoxy-N-[(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]benzamide (PubChem CID 17109914) has the molecular formula C25H31N3O2S2 and a molecular weight of 469.68 g/mol. Its IUPAC name is 4-butoxy-N-[(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]benzamide.
| Compound Name | 4-butoxy-N-[(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17109914 |
| Molecular Formula | C25H31N3O2S2 |
| Molecular Weight | 469.68 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 4-butoxy-N-[(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NC(=S)Nc2sc3c(c2C#N)CCC(C(C)(C)C)C3)cc1 |
| InChI | InChI=1S/C25H31N3O2S2/c1-5-6-13-30-18-10-7-16(8-11-18)22(29)27-24(31)28-23-20(15-26)19-12-9-17(25(2,3)4)14-21(19)32-23/h7-8,10-11,17H,5-6,9,12-14H2,1-4H3,(H2,27,28,29,31) |
| InChIKey | SNFHOFARLUOJAG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.68 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|