C17H23N3OS2 — CID 26012806
N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]propanamide (PubChem CID 26012806) has the molecular formula C17H23N3OS2 and a molecular weight of 349.53 g/mol. Its IUPAC name is N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]propanamide.
| Compound Name | N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]propanamide |
|---|---|
| PubChem CID | 26012806 |
| Molecular Formula | C17H23N3OS2 |
| Molecular Weight | 349.53 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]propanamide |
| SMILES | CCC(=O)NC(=S)Nc1sc2c(c1C#N)CC[C@@H](C(C)(C)C)C2 |
| InChI | InChI=1S/C17H23N3OS2/c1-5-14(21)19-16(22)20-15-12(9-18)11-7-6-10(17(2,3)4)8-13(11)23-15/h10H,5-8H2,1-4H3,(H2,19,20,21,22)/t10-/m1/s1 |
| InChIKey | ZFTHWAIWOIKKQW-SNVBAGLBSA-N |
| XLogP | 3.99 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|