C21H22ClN3OS2 — CID 22779594
N-[(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-3-chlorobenzamide (PubChem CID 22779594) has the molecular formula C21H22ClN3OS2 and a molecular weight of 432.01 g/mol. Its IUPAC name is N-[(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-3-chlorobenzamide.
| Compound Name | N-[(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 22779594 |
| Molecular Formula | C21H22ClN3OS2 |
| Molecular Weight | 432.01 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | N-[(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-3-chlorobenzamide |
| SMILES | CC(C)(C)C1CCc2c(sc(NC(=S)NC(=O)c3cccc(Cl)c3)c2C#N)C1 |
| InChI | InChI=1S/C21H22ClN3OS2/c1-21(2,3)13-7-8-15-16(11-23)19(28-17(15)10-13)25-20(27)24-18(26)12-5-4-6-14(22)9-12/h4-6,9,13H,7-8,10H2,1-3H3,(H2,24,25,26,27) |
| InChIKey | JMFJSCDMCNUZKB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.01 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|