C25H31N3OS2 — CID 26019165
4-tert-butyl-N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]benzamide (PubChem CID 26019165) has the molecular formula C25H31N3OS2 and a molecular weight of 453.68 g/mol. Its IUPAC name is 4-tert-butyl-N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]benzamide.
| Compound Name | 4-tert-butyl-N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 26019165 |
| Molecular Formula | C25H31N3OS2 |
| Molecular Weight | 453.68 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 4-tert-butyl-N-[[(6R)-6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamothioyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(=S)Nc2sc3c(c2C#N)CC[C@@H](C(C)(C)C)C3)cc1 |
| InChI | InChI=1S/C25H31N3OS2/c1-24(2,3)16-9-7-15(8-10-16)21(29)27-23(30)28-22-19(14-26)18-12-11-17(25(4,5)6)13-20(18)31-22/h7-10,17H,11-13H2,1-6H3,(H2,27,28,29,30)/t17-/m1/s1 |
| InChIKey | DDRSHXKETPMINK-QGZVFWFLSA-N |
| XLogP | 6.20 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.68 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|