C17H21N2O3S- — CID 3678738
4-[(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobutanoate (PubChem CID 3678738) has the molecular formula C17H21N2O3S- and a molecular weight of 333.43 g/mol. Its IUPAC name is 4-[(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobutanoate.
| Compound Name | 4-[(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 3678738 |
| Molecular Formula | C17H21N2O3S- |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 4-[(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobutanoate |
| SMILES | CC(C)(C)C1CCc2c(sc(NC(=O)CCC(=O)[O-])c2C#N)C1 |
| InChI | InChI=1S/C17H22N2O3S/c1-17(2,3)10-4-5-11-12(9-18)16(23-13(11)8-10)19-14(20)6-7-15(21)22/h10H,4-8H2,1-3H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | TTYLSZMKPHQQSZ-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_C(7)', 'substructure': 'N/A'} |
|---|