C24H30N2O2S — CID 4117507
4-butoxy-N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)benzamide (PubChem CID 4117507) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is 4-butoxy-N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)benzamide.
| Compound Name | 4-butoxy-N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)benzamide |
|---|---|
| PubChem CID | 4117507 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 4-butoxy-N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2sc3c(c2C#N)CCC(C(C)(C)C)C3)cc1 |
| InChI | InChI=1S/C24H30N2O2S/c1-5-6-13-28-18-10-7-16(8-11-18)22(27)26-23-20(15-25)19-12-9-17(24(2,3)4)14-21(19)29-23/h7-8,10-11,17H,5-6,9,12-14H2,1-4H3,(H,26,27) |
| InChIKey | KKSAICFYOKWPJD-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|