C31H44N2O5S2 — CID 18817704
6-tert-butyl-N-(1,1-dioxothiolan-3-yl)-2-[(4-heptoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 18817704) has the molecular formula C31H44N2O5S2 and a molecular weight of 588.84 g/mol. Its IUPAC name is 6-tert-butyl-N-(1,1-dioxothiolan-3-yl)-2-[(4-heptoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 6-tert-butyl-N-(1,1-dioxothiolan-3-yl)-2-[(4-heptoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 18817704 |
| Molecular Formula | C31H44N2O5S2 |
| Molecular Weight | 588.84 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | 6-tert-butyl-N-(1,1-dioxothiolan-3-yl)-2-[(4-heptoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCCCCCCOc1ccc(C(=O)Nc2sc3c(c2C(=O)NC2CCS(=O)(=O)C2)CCC(C(C)(C)C)C3)cc1 |
| InChI | InChI=1S/C31H44N2O5S2/c1-5-6-7-8-9-17-38-24-13-10-21(11-14-24)28(34)33-30-27(29(35)32-23-16-18-40(36,37)20-23)25-15-12-22(31(2,3)4)19-26(25)39-30/h10-11,13-14,22-23H,5-9,12,15-20H2,1-4H3,(H,32,35)(H,33,34) |
| InChIKey | OQHNTPZDCBPLRE-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.84 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|