C23H28N2O5S2 — CID 35042726
2-[(3-butoxybenzoyl)amino]-N-[(3S)-1,1-dioxothiolan-3-yl]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (PubChem CID 35042726) has the molecular formula C23H28N2O5S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is 2-[(3-butoxybenzoyl)amino]-N-[(3S)-1,1-dioxothiolan-3-yl]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
| Compound Name | 2-[(3-butoxybenzoyl)amino]-N-[(3S)-1,1-dioxothiolan-3-yl]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 35042726 |
| Molecular Formula | C23H28N2O5S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 2-[(3-butoxybenzoyl)amino]-N-[(3S)-1,1-dioxothiolan-3-yl]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| SMILES | CCCCOc1cccc(C(=O)Nc2sc3c(c2C(=O)N[C@H]2CCS(=O)(=O)C2)CCC3)c1 |
| InChI | InChI=1S/C23H28N2O5S2/c1-2-3-11-30-17-7-4-6-15(13-17)21(26)25-23-20(18-8-5-9-19(18)31-23)22(27)24-16-10-12-32(28,29)14-16/h4,6-7,13,16H,2-3,5,8-12,14H2,1H3,(H,24,27)(H,25,26)/t16-/m0/s1 |
| InChIKey | RSVVBJKVNLQRRN-INIZCTEOSA-N |
| XLogP | 3.58 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|