C28H38N2O7S — CID 139403887
6-tert-butyl-2-[[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboperoxoic acid (PubChem CID 139403887) has the molecular formula C28H38N2O7S and a molecular weight of 546.69 g/mol. Its IUPAC name is 6-tert-butyl-2-[[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboperoxoic acid.
| Compound Name | 6-tert-butyl-2-[[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboperoxoic acid |
|---|---|
| PubChem CID | 139403887 |
| Molecular Formula | C28H38N2O7S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 6-tert-butyl-2-[[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboperoxoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCOc1ccc(C(=O)Nc2sc3c(c2C(=O)OO)CCC(C(C)(C)C)C3)cc1 |
| InChI | InChI=1S/C28H38N2O7S/c1-27(2,3)18-10-13-20-21(16-18)38-24(22(20)25(32)37-34)30-23(31)17-8-11-19(12-9-17)35-15-7-14-29-26(33)36-28(4,5)6/h8-9,11-12,18,34H,7,10,13-16H2,1-6H3,(H,29,33)(H,30,31) |
| InChIKey | ZUBYJEKUSSBEMN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|