C26H35NO4S — CID 4258414
methyl 6-tert-butyl-2-[4-(4-ethylphenoxy)butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4258414) has the molecular formula C26H35NO4S and a molecular weight of 457.64 g/mol. Its IUPAC name is methyl 6-tert-butyl-2-[4-(4-ethylphenoxy)butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 6-tert-butyl-2-[4-(4-ethylphenoxy)butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4258414 |
| Molecular Formula | C26H35NO4S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | methyl 6-tert-butyl-2-[4-(4-ethylphenoxy)butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCc1ccc(OCCCC(=O)Nc2sc3c(c2C(=O)OC)CCC(C(C)(C)C)C3)cc1 |
| InChI | InChI=1S/C26H35NO4S/c1-6-17-9-12-19(13-10-17)31-15-7-8-22(28)27-24-23(25(29)30-5)20-14-11-18(26(2,3)4)16-21(20)32-24/h9-10,12-13,18H,6-8,11,14-16H2,1-5H3,(H,27,28) |
| InChIKey | LKBSZENYRVPZEM-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|