C34H48N2O6S2 — CID 4643298
ethyl 6-tert-butyl-2-[[4-[(6-tert-butyl-3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobutanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4643298) has the molecular formula C34H48N2O6S2 and a molecular weight of 644.90 g/mol. Its IUPAC name is ethyl 6-tert-butyl-2-[[4-[(6-tert-butyl-3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobutanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 6-tert-butyl-2-[[4-[(6-tert-butyl-3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobutanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4643298 |
| Molecular Formula | C34H48N2O6S2 |
| Molecular Weight | 644.90 g/mol |
| Exact Mass | 644.30 |
| IUPAC Name | ethyl 6-tert-butyl-2-[[4-[(6-tert-butyl-3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-4-oxobutanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCC(=O)Nc2sc3c(c2C(=O)OCC)CCC(C(C)(C)C)C3)sc2c1CCC(C(C)(C)C)C2 |
| InChI | InChI=1S/C34H48N2O6S2/c1-9-41-31(39)27-21-13-11-19(33(3,4)5)17-23(21)43-29(27)35-25(37)15-16-26(38)36-30-28(32(40)42-10-2)22-14-12-20(34(6,7)8)18-24(22)44-30/h19-20H,9-18H2,1-8H3,(H,35,37)(H,36,38) |
| InChIKey | BUQXZSOCUNDEMH-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.90 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_C(7)', 'substructure': 'N/A'} |
|---|