C27H37NO4S — CID 3627597
ethyl 6-tert-butyl-2-[4-(4-ethylphenoxy)butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3627597) has the molecular formula C27H37NO4S and a molecular weight of 471.66 g/mol. Its IUPAC name is ethyl 6-tert-butyl-2-[4-(4-ethylphenoxy)butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 6-tert-butyl-2-[4-(4-ethylphenoxy)butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3627597 |
| Molecular Formula | C27H37NO4S |
| Molecular Weight | 471.66 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | ethyl 6-tert-butyl-2-[4-(4-ethylphenoxy)butanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCCOc2ccc(CC)cc2)sc2c1CCC(C(C)(C)C)C2 |
| InChI | InChI=1S/C27H37NO4S/c1-6-18-10-13-20(14-11-18)32-16-8-9-23(29)28-25-24(26(30)31-7-2)21-15-12-19(27(3,4)5)17-22(21)33-25/h10-11,13-14,19H,6-9,12,15-17H2,1-5H3,(H,28,29) |
| InChIKey | ISOQSEPPDMRABT-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.66 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|