C28H38N2O5S2 — CID 18817716
6-tert-butyl-2-[2-(3,5-dimethylphenoxy)propanoylamino]-N-(1,1-dioxothiolan-3-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 18817716) has the molecular formula C28H38N2O5S2 and a molecular weight of 546.76 g/mol. Its IUPAC name is 6-tert-butyl-2-[2-(3,5-dimethylphenoxy)propanoylamino]-N-(1,1-dioxothiolan-3-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 6-tert-butyl-2-[2-(3,5-dimethylphenoxy)propanoylamino]-N-(1,1-dioxothiolan-3-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 18817716 |
| Molecular Formula | C28H38N2O5S2 |
| Molecular Weight | 546.76 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | 6-tert-butyl-2-[2-(3,5-dimethylphenoxy)propanoylamino]-N-(1,1-dioxothiolan-3-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1cc(C)cc(OC(C)C(=O)Nc2sc3c(c2C(=O)NC2CCS(=O)(=O)C2)CCC(C(C)(C)C)C3)c1 |
| InChI | InChI=1S/C28H38N2O5S2/c1-16-11-17(2)13-21(12-16)35-18(3)25(31)30-27-24(26(32)29-20-9-10-37(33,34)15-20)22-8-7-19(28(4,5)6)14-23(22)36-27/h11-13,18-20H,7-10,14-15H2,1-6H3,(H,29,32)(H,30,31) |
| InChIKey | DBSAGYKPPURVTR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.76 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |