C25H31ClN2O5S2 — CID 18817631
2-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]-N-(1,1-dioxothiolan-3-yl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 18817631) has the molecular formula C25H31ClN2O5S2 and a molecular weight of 539.12 g/mol. Its IUPAC name is 2-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]-N-(1,1-dioxothiolan-3-yl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]-N-(1,1-dioxothiolan-3-yl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 18817631 |
| Molecular Formula | C25H31ClN2O5S2 |
| Molecular Weight | 539.12 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 2-[2-(4-chloro-3,5-dimethylphenoxy)propanoylamino]-N-(1,1-dioxothiolan-3-yl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1cc(OC(C)C(=O)Nc2sc3c(c2C(=O)NC2CCS(=O)(=O)C2)CCC(C)C3)cc(C)c1Cl |
| InChI | InChI=1S/C25H31ClN2O5S2/c1-13-5-6-19-20(9-13)34-25(21(19)24(30)27-17-7-8-35(31,32)12-17)28-23(29)16(4)33-18-10-14(2)22(26)15(3)11-18/h10-11,13,16-17H,5-9,12H2,1-4H3,(H,27,30)(H,28,29) |
| InChIKey | KLCBMFKBWYEZTG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.12 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |