C21H22ClN3O6S2 — CID 18817612
2-[(4-chloro-3-nitrobenzoyl)amino]-N-(1,1-dioxothiolan-3-yl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 18817612) has the molecular formula C21H22ClN3O6S2 and a molecular weight of 512.01 g/mol. Its IUPAC name is 2-[(4-chloro-3-nitrobenzoyl)amino]-N-(1,1-dioxothiolan-3-yl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[(4-chloro-3-nitrobenzoyl)amino]-N-(1,1-dioxothiolan-3-yl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 18817612 |
| Molecular Formula | C21H22ClN3O6S2 |
| Molecular Weight | 512.01 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | 2-[(4-chloro-3-nitrobenzoyl)amino]-N-(1,1-dioxothiolan-3-yl)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC1CCc2c(sc(NC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)c2C(=O)NC2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C21H22ClN3O6S2/c1-11-2-4-14-17(8-11)32-21(18(14)20(27)23-13-6-7-33(30,31)10-13)24-19(26)12-3-5-15(22)16(9-12)25(28)29/h3,5,9,11,13H,2,4,6-8,10H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | DNKGLPPQICJEHW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.01 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|