C23H22Cl2N2O4S3 — CID 18817746
3,6-dichloro-N-[3-[(1,1-dioxothiolan-3-yl)carbamoyl]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 18817746) has the molecular formula C23H22Cl2N2O4S3 and a molecular weight of 557.55 g/mol. Its IUPAC name is 3,6-dichloro-N-[3-[(1,1-dioxothiolan-3-yl)carbamoyl]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[3-[(1,1-dioxothiolan-3-yl)carbamoyl]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 18817746 |
| Molecular Formula | C23H22Cl2N2O4S3 |
| Molecular Weight | 557.55 g/mol |
| Exact Mass | 556.01 |
| IUPAC Name | 3,6-dichloro-N-[3-[(1,1-dioxothiolan-3-yl)carbamoyl]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | CC1CCc2c(sc(NC(=O)c3sc4cc(Cl)ccc4c3Cl)c2C(=O)NC2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C23H22Cl2N2O4S3/c1-11-2-4-14-16(8-11)33-23(18(14)21(28)26-13-6-7-34(30,31)10-13)27-22(29)20-19(25)15-5-3-12(24)9-17(15)32-20/h3,5,9,11,13H,2,4,6-8,10H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | CHGZMBQLMSZUBU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |