C30H35ClN4O6S3 — CID 19119884
N-[6-tert-butyl-3-[(1,1-dioxothiolan-3-yl)carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-5-chloro-2-[(3-methylphenyl)methylsulfonyl]pyrimidine-4-carboxamide (PubChem CID 19119884) has the molecular formula C30H35ClN4O6S3 and a molecular weight of 679.29 g/mol. Its IUPAC name is N-[6-tert-butyl-3-[(1,1-dioxothiolan-3-yl)carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-5-chloro-2-[(3-methylphenyl)methylsulfonyl]pyrimidine-4-carboxamide.
| Compound Name | N-[6-tert-butyl-3-[(1,1-dioxothiolan-3-yl)carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-5-chloro-2-[(3-methylphenyl)methylsulfonyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 19119884 |
| Molecular Formula | C30H35ClN4O6S3 |
| Molecular Weight | 679.29 g/mol |
| Exact Mass | 678.14 |
| IUPAC Name | N-[6-tert-butyl-3-[(1,1-dioxothiolan-3-yl)carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-5-chloro-2-[(3-methylphenyl)methylsulfonyl]pyrimidine-4-carboxamide |
| SMILES | Cc1cccc(CS(=O)(=O)c2ncc(Cl)c(C(=O)Nc3sc4c(c3C(=O)NC3CCS(=O)(=O)C3)CCC(C(C)(C)C)C4)n2)c1 |
| InChI | InChI=1S/C30H35ClN4O6S3/c1-17-6-5-7-18(12-17)15-44(40,41)29-32-14-22(31)25(34-29)27(37)35-28-24(26(36)33-20-10-11-43(38,39)16-20)21-9-8-19(30(2,3)4)13-23(21)42-28/h5-7,12,14,19-20H,8-11,13,15-16H2,1-4H3,(H,33,36)(H,35,37) |
| InChIKey | NBDMIMVXTWGGBL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 152.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.29 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |