C23H29N3O3S2 — CID 17109947
6-tert-butyl-2-[(4-ethoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 17109947) has the molecular formula C23H29N3O3S2 and a molecular weight of 459.64 g/mol. Its IUPAC name is 6-tert-butyl-2-[(4-ethoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 6-tert-butyl-2-[(4-ethoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 17109947 |
| Molecular Formula | C23H29N3O3S2 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 6-tert-butyl-2-[(4-ethoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2sc3c(c2C(N)=O)CCC(C(C)(C)C)C3)cc1 |
| InChI | InChI=1S/C23H29N3O3S2/c1-5-29-15-9-6-13(7-10-15)20(28)25-22(30)26-21-18(19(24)27)16-11-8-14(23(2,3)4)12-17(16)31-21/h6-7,9-10,14H,5,8,11-12H2,1-4H3,(H2,24,27)(H2,25,26,28,30) |
| InChIKey | WNDQMOKGUHISNO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|